C33H42N2O5Si — CID 23957710
N-benzyl-2-[(2S,3R,4S,5R)-5-[2-[4-(N-formylanilino)phenyl]ethyl]-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23957710) has the molecular formula C33H42N2O5Si and a molecular weight of 574.79 g/mol. Its IUPAC name is N-benzyl-2-[(2S,3R,4S,5R)-5-[2-[4-(N-formylanilino)phenyl]ethyl]-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2S,3R,4S,5R)-5-[2-[4-(N-formylanilino)phenyl]ethyl]-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23957710 |
| Molecular Formula | C33H42N2O5Si |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | N-benzyl-2-[(2S,3R,4S,5R)-5-[2-[4-(N-formylanilino)phenyl]ethyl]-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@H]1CCc1ccc(N(C=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H42N2O5Si/c1-25-30(19-16-26-14-17-29(18-15-26)35(24-37)28-12-8-5-9-13-28)40-31(33(25)41(2,3)39)22-32(38)34(20-21-36)23-27-10-6-4-7-11-27/h4-15,17-18,24-25,30-31,33,36,39H,16,19-23H2,1-3H3/t25-,30+,31-,33+/m0/s1 |
| InChIKey | BXMHGSRAORVTRD-YCRAGPFNSA-N |
| XLogP | 5.30 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|