C39H43FN2O5Si — CID 23873961
N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[4-(6-oxobenzo[b][1,4]benzoxazepin-5-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23873961) has the molecular formula C39H43FN2O5Si and a molecular weight of 666.87 g/mol. Its IUPAC name is N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[4-(6-oxobenzo[b][1,4]benzoxazepin-5-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[4-(6-oxobenzo[b][1,4]benzoxazepin-5-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23873961 |
| Molecular Formula | C39H43FN2O5Si |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[4-(6-oxobenzo[b][1,4]benzoxazepin-5-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@H]1CCc1ccc(N2C(=O)c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C39H43FN2O5Si/c1-27-33(46-36(38(27)48(2,3)40)25-37(44)41(23-24-43)26-29-11-5-4-6-12-29)22-19-28-17-20-30(21-18-28)42-32-14-8-10-16-35(32)47-34-15-9-7-13-31(34)39(42)45/h4-18,20-21,27,33,36,38,43H,19,22-26H2,1-3H3/t27-,33+,36-,38+/m1/s1 |
| InChIKey | LCKMXSBCLXDCCH-XBFOOJMDSA-N |
| XLogP | 8.06 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|