C26H35FINO3Si — CID 23985518
N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23985518) has the molecular formula C26H35FINO3Si and a molecular weight of 583.56 g/mol. Its IUPAC name is N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23985518 |
| Molecular Formula | C26H35FINO3Si |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@H]1CCc1ccc(I)cc1 |
| InChI | InChI=1S/C26H35FINO3Si/c1-19-23(14-11-20-9-12-22(28)13-10-20)32-24(26(19)33(2,3)27)17-25(31)29(15-16-30)18-21-7-5-4-6-8-21/h4-10,12-13,19,23-24,26,30H,11,14-18H2,1-3H3/t19-,23+,24-,26+/m0/s1 |
| InChIKey | FIPRYRONAVFAGJ-CEKSUIHGSA-N |
| XLogP | 5.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|