C33H42INO4Si — CID 23929901
N-benzyl-N-(2-hydroxyethyl)-2-[(2S,3R,4S,5R)-5-[2-(4-iodophenyl)ethyl]-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]acetamide (PubChem CID 23929901) has the molecular formula C33H42INO4Si and a molecular weight of 671.69 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-2-[(2S,3R,4S,5R)-5-[2-(4-iodophenyl)ethyl]-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]acetamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-2-[(2S,3R,4S,5R)-5-[2-(4-iodophenyl)ethyl]-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 23929901 |
| Molecular Formula | C33H42INO4Si |
| Molecular Weight | 671.69 g/mol |
| Exact Mass | 671.19 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-2-[(2S,3R,4S,5R)-5-[2-(4-iodophenyl)ethyl]-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]acetamide |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](C)[C@@H](CCc3ccc(I)cc3)O[C@H]2CC(=O)N(CCO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H42INO4Si/c1-24-30(19-12-25-10-13-27(34)14-11-25)39-31(33(24)40(3,4)29-17-15-28(38-2)16-18-29)22-32(37)35(20-21-36)23-26-8-6-5-7-9-26/h5-11,13-18,24,30-31,33,36H,12,19-23H2,1-4H3/t24-,30+,31-,33+/m0/s1 |
| InChIKey | JFTPYMDCTIRODB-XFZVPMLWSA-N |
| XLogP | 6.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|