C33H39IN2O5Si — CID 23872360
N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-5-iodo-3'-[(4-methoxyphenyl)-dimethylsilyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]acetamide (PubChem CID 23872360) has the molecular formula C33H39IN2O5Si and a molecular weight of 698.67 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-5-iodo-3'-[(4-methoxyphenyl)-dimethylsilyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]acetamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-5-iodo-3'-[(4-methoxyphenyl)-dimethylsilyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]acetamide |
|---|---|
| PubChem CID | 23872360 |
| Molecular Formula | C33H39IN2O5Si |
| Molecular Weight | 698.67 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-5-iodo-3'-[(4-methoxyphenyl)-dimethylsilyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]acetamide |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CC(=O)N(CCO)Cc3ccccc3)O[C@]3(C(=O)N(C)c4ccc(I)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C33H39IN2O5Si/c1-22-31(42(4,5)26-14-12-25(40-3)13-15-26)29(20-30(38)36(17-18-37)21-23-9-7-6-8-10-23)41-33(22)27-19-24(34)11-16-28(27)35(2)32(33)39/h6-16,19,22,29,31,37H,17-18,20-21H2,1-5H3/t22-,29+,31-,33+/m0/s1 |
| InChIKey | NQDZVIRCWJOZMQ-ZVTQMECVSA-N |
| XLogP | 4.90 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|