C26H33ClN2O5Si — CID 23844344
N-benzyl-2-[(2'R,3R,3'S,4'R)-5-chloro-3'-[hydroxy(dimethyl)silyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23844344) has the molecular formula C26H33ClN2O5Si and a molecular weight of 517.10 g/mol. Its IUPAC name is N-benzyl-2-[(2'R,3R,3'S,4'R)-5-chloro-3'-[hydroxy(dimethyl)silyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2'R,3R,3'S,4'R)-5-chloro-3'-[hydroxy(dimethyl)silyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23844344 |
| Molecular Formula | C26H33ClN2O5Si |
| Molecular Weight | 517.10 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-benzyl-2-[(2'R,3R,3'S,4'R)-5-chloro-3'-[hydroxy(dimethyl)silyl]-1,4'-dimethyl-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@]12C(=O)N(C)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C26H33ClN2O5Si/c1-17-24(35(3,4)33)22(15-23(31)29(12-13-30)16-18-8-6-5-7-9-18)34-26(17)20-14-19(27)10-11-21(20)28(2)25(26)32/h5-11,14,17,22,24,30,33H,12-13,15-16H2,1-4H3/t17-,22+,24-,26+/m0/s1 |
| InChIKey | IRCZKECHVPEDOH-HEIHPFCESA-N |
| XLogP | 3.53 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.10 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|