C31H39N3O8Si — CID 23786733
[1-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate (PubChem CID 23786733) has the molecular formula C31H39N3O8Si and a molecular weight of 609.75 g/mol. Its IUPAC name is [1-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 23786733 |
| Molecular Formula | C31H39N3O8Si |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | [1-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)N1c1ccc2c(c1)[C@@]1(O[C@H](CC(=O)N(CCO)Cc3ccccc3)[C@@H]([Si](C)(C)O)[C@@H]1C)C(=O)N2C |
| InChI | InChI=1S/C31H39N3O8Si/c1-19-29(43(4,5)40)25(16-26(37)33(13-14-35)18-21-9-7-6-8-10-21)42-31(19)23-15-22(11-12-24(23)32(3)30(31)39)34-27(38)17-28(34)41-20(2)36/h6-12,15,19,25,28-29,35,40H,13-14,16-18H2,1-5H3/t19-,25+,28?,29-,31+/m0/s1 |
| InChIKey | UYPYTCSGPZFTCP-LGJGEWLGSA-N |
| XLogP | 2.50 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|