C31H39NO4Si — CID 23929808
N-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-N-phenylformamide (PubChem CID 23929808) has the molecular formula C31H39NO4Si and a molecular weight of 517.74 g/mol. Its IUPAC name is N-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-N-phenylformamide.
| Compound Name | N-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-N-phenylformamide |
|---|---|
| PubChem CID | 23929808 |
| Molecular Formula | C31H39NO4Si |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-N-phenylformamide |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](C)[C@H](CCc3cccc(N(C=O)c4ccccc4)c3)O[C@@H]2CCO)cc1 |
| InChI | InChI=1S/C31H39NO4Si/c1-23-29(18-13-24-9-8-12-26(21-24)32(22-34)25-10-6-5-7-11-25)36-30(19-20-33)31(23)37(3,4)28-16-14-27(35-2)15-17-28/h5-12,14-17,21-23,29-31,33H,13,18-20H2,1-4H3/t23-,29+,30-,31+/m1/s1 |
| InChIKey | TZHIKCMQYOKLHZ-XEYRIRSISA-N |
| XLogP | 5.69 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|