C31H40N2O4Si — CID 23759564
4-amino-N-[4-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide (PubChem CID 23759564) has the molecular formula C31H40N2O4Si and a molecular weight of 532.76 g/mol. Its IUPAC name is 4-amino-N-[4-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23759564 |
| Molecular Formula | C31H40N2O4Si |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 4-amino-N-[4-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](C)[C@H](CCc3ccc(NC(=O)c4ccc(N)cc4)cc3)O[C@@H]2CCO)cc1 |
| InChI | InChI=1S/C31H40N2O4Si/c1-21-28(37-29(19-20-34)30(21)38(3,4)27-16-14-26(36-2)15-17-27)18-7-22-5-12-25(13-6-22)33-31(35)23-8-10-24(32)11-9-23/h5-6,8-17,21,28-30,34H,7,18-20,32H2,1-4H3,(H,33,35)/t21-,28+,29-,30+/m1/s1 |
| InChIKey | YWIKPOSULNPZBV-YUJRYHFISA-N |
| XLogP | 5.23 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|