C30H35N3O5Si — CID 23900213
4-amino-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23900213) has the molecular formula C30H35N3O5Si and a molecular weight of 545.71 g/mol. Its IUPAC name is 4-amino-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | 4-amino-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23900213 |
| Molecular Formula | C30H35N3O5Si |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 4-amino-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)Nc4ccc(NC(=O)c5ccc(N)cc5)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C30H35N3O5Si/c1-18-27(39(3,4)23-12-10-22(37-2)11-13-23)26(15-16-34)38-30(18)24-17-21(9-14-25(24)33-29(30)36)32-28(35)19-5-7-20(31)8-6-19/h5-14,17-18,26-27,34H,15-16,31H2,1-4H3,(H,32,35)(H,33,36)/t18-,26+,27-,30+/m0/s1 |
| InChIKey | QFRBVAFAKLMZRN-GCBBNJKYSA-N |
| XLogP | 4.08 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|