C27H33FN2O5Si — CID 23976276
N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide (PubChem CID 23976276) has the molecular formula C27H33FN2O5Si and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide.
| Compound Name | N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23976276 |
| Molecular Formula | C27H33FN2O5Si |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide |
| SMILES | C=CCN1C(=O)[C@@]2(O[C@@H](CCO)[C@H]([Si](C)(C)F)[C@H]2C)c2cc(NC(=O)c3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C27H33FN2O5Si/c1-6-14-30-22-12-9-19(29-25(32)18-7-10-20(34-3)11-8-18)16-21(22)27(26(30)33)17(2)24(36(4,5)28)23(35-27)13-15-31/h6-12,16-17,23-24,31H,1,13-15H2,2-5H3,(H,29,32)/t17-,23+,24-,27+/m1/s1 |
| InChIKey | DDFMERPWXQGRJB-XGBYBTARSA-N |
| XLogP | 4.64 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|