C28H39N5O4Si — CID 23929887
4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide (PubChem CID 23929887) has the molecular formula C28H39N5O4Si and a molecular weight of 537.74 g/mol. Its IUPAC name is 4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23929887 |
| Molecular Formula | C28H39N5O4Si |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCn2cc(CCO)nn2)O[C@@H]1CCc1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C28H39N5O4Si/c1-19-25(37-26(27(19)38(2,3)36)14-16-33-18-24(15-17-34)31-32-33)13-6-20-4-11-23(12-5-20)30-28(35)21-7-9-22(29)10-8-21/h4-5,7-12,18-19,25-27,34,36H,6,13-17,29H2,1-3H3,(H,30,35)/t19-,25+,26-,27+/m0/s1 |
| InChIKey | RBFWPMPRTBPPMD-DWJNZRAMSA-N |
| XLogP | 3.64 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|