C34H42FN5O3Si — CID 23985466
4-amino-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide (PubChem CID 23985466) has the molecular formula C34H42FN5O3Si and a molecular weight of 615.83 g/mol. Its IUPAC name is 4-amino-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23985466 |
| Molecular Formula | C34H42FN5O3Si |
| Molecular Weight | 615.83 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 4-amino-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@H]1CCc1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C34H42FN5O3Si/c1-23-31(18-11-24-9-16-28(17-10-24)37-34(42)26-12-14-27(36)15-13-26)43-32(33(23)44(2,3)35)19-20-40-21-30(38-39-40)29(22-41)25-7-5-4-6-8-25/h4-10,12-17,21,23,29,31-33,41H,11,18-20,22,36H2,1-3H3,(H,37,42)/t23-,29?,31+,32-,33+/m1/s1 |
| InChIKey | QZQYTNMTHGRPGS-BIKKNTDTSA-N |
| XLogP | 6.21 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|