C33H46FN5O3Si — CID 23957636
N-[3-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide (PubChem CID 23957636) has the molecular formula C33H46FN5O3Si and a molecular weight of 607.85 g/mol. Its IUPAC name is N-[3-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide.
| Compound Name | N-[3-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23957636 |
| Molecular Formula | C33H46FN5O3Si |
| Molecular Weight | 607.85 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | N-[3-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@H]1CCc1cccc(NC(=O)C2CCCNC2)c1 |
| InChI | InChI=1S/C33H46FN5O3Si/c1-23-30(15-14-24-9-7-13-27(19-24)36-33(41)26-12-8-17-35-20-26)42-31(32(23)43(2,3)34)16-18-39-21-29(37-38-39)28(22-40)25-10-5-4-6-11-25/h4-7,9-11,13,19,21,23,26,28,30-32,35,40H,8,12,14-18,20,22H2,1-3H3,(H,36,41)/t23-,26?,28?,30+,31-,32+/m1/s1 |
| InChIKey | JXZMIPGTGPSQBM-RHQBULDLSA-N |
| XLogP | 5.31 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|