C27H36IN3O3Si — CID 23957637
2-[1-[2-[(2R,3S,4R,5S)-3-[hydroxy(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]-2-phenylethanol (PubChem CID 23957637) has the molecular formula C27H36IN3O3Si and a molecular weight of 605.59 g/mol. Its IUPAC name is 2-[1-[2-[(2R,3S,4R,5S)-3-[hydroxy(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]-2-phenylethanol.
| Compound Name | 2-[1-[2-[(2R,3S,4R,5S)-3-[hydroxy(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 23957637 |
| Molecular Formula | C27H36IN3O3Si |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 2-[1-[2-[(2R,3S,4R,5S)-3-[hydroxy(dimethyl)silyl]-5-[2-(4-iodophenyl)ethyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]-2-phenylethanol |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@H]1CCc1ccc(I)cc1 |
| InChI | InChI=1S/C27H36IN3O3Si/c1-19-25(14-11-20-9-12-22(28)13-10-20)34-26(27(19)35(2,3)33)15-16-31-17-24(29-30-31)23(18-32)21-7-5-4-6-8-21/h4-10,12-13,17,19,23,25-27,32-33H,11,14-16,18H2,1-3H3/t19-,23?,25+,26-,27+/m1/s1 |
| InChIKey | VEYUQCPFWRMMPG-QRYMHJJQSA-N |
| XLogP | 5.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|