C36H43FN4O3Si — CID 23788552
1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 23788552) has the molecular formula C36H43FN4O3Si and a molecular weight of 626.85 g/mol. Its IUPAC name is 1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 23788552 |
| Molecular Formula | C36H43FN4O3Si |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@H]1CCc1ccc(N2C(=O)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C36H43FN4O3Si/c1-25-33(19-15-26-13-17-29(18-14-26)41-32-12-8-7-11-28(32)16-20-35(41)43)44-34(36(25)45(2,3)37)21-22-40-23-31(38-39-40)30(24-42)27-9-5-4-6-10-27/h4-14,17-18,23,25,30,33-34,36,42H,15-16,19-22,24H2,1-3H3/t25-,30?,33+,34-,36+/m1/s1 |
| InChIKey | YUYXDWLKVKSKTO-BKUKYLJUSA-N |
| XLogP | 6.98 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|