C32H47N3O5Si — CID 23929851
N-[3-[2-[(2S,3R,4S,5R)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide (PubChem CID 23929851) has the molecular formula C32H47N3O5Si and a molecular weight of 581.83 g/mol. Its IUPAC name is N-[3-[2-[(2S,3R,4S,5R)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide.
| Compound Name | N-[3-[2-[(2S,3R,4S,5R)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23929851 |
| Molecular Formula | C32H47N3O5Si |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | N-[3-[2-[(2S,3R,4S,5R)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidine-3-carboxamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@H]1CCc1cccc(NC(=O)C2CCCNC2)c1 |
| InChI | InChI=1S/C32H47N3O5Si/c1-23-28(15-14-24-11-7-13-27(19-24)34-32(38)26-12-8-16-33-21-26)40-29(31(23)41(2,3)39)20-30(37)35(17-18-36)22-25-9-5-4-6-10-25/h4-7,9-11,13,19,23,26,28-29,31,33,36,39H,8,12,14-18,20-22H2,1-3H3,(H,34,38)/t23-,26?,28+,29-,31+/m1/s1 |
| InChIKey | ZKNXALDIUGEZOM-ZDVRPNDGSA-N |
| XLogP | 3.94 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|