C31H45N3O5Si — CID 23901880
(2R)-N-[4-[2-[(2R,3S,4R,5S)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 23901880) has the molecular formula C31H45N3O5Si and a molecular weight of 567.80 g/mol. Its IUPAC name is (2R)-N-[4-[2-[(2R,3S,4R,5S)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[4-[2-[(2R,3S,4R,5S)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23901880 |
| Molecular Formula | C31H45N3O5Si |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | (2R)-N-[4-[2-[(2R,3S,4R,5S)-5-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4-[hydroxy(dimethyl)silyl]-3-methyloxolan-2-yl]ethyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@H]1CCc1ccc(NC(=O)[C@H]2CCCN2)cc1 |
| InChI | InChI=1S/C31H45N3O5Si/c1-22-27(16-13-23-11-14-25(15-12-23)33-31(37)26-10-7-17-32-26)39-28(30(22)40(2,3)38)20-29(36)34(18-19-35)21-24-8-5-4-6-9-24/h4-6,8-9,11-12,14-15,22,26-28,30,32,35,38H,7,10,13,16-21H2,1-3H3,(H,33,37)/t22-,26+,27+,28-,30+/m0/s1 |
| InChIKey | FIXWNEGQZAZVKH-DBXUVXQGSA-N |
| XLogP | 3.69 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|