C34H43N3O5Si — CID 23817493
4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide (PubChem CID 23817493) has the molecular formula C34H43N3O5Si and a molecular weight of 601.82 g/mol. Its IUPAC name is 4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23817493 |
| Molecular Formula | C34H43N3O5Si |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | 4-amino-N-[4-[2-[(2R,3S,4R,5S)-4-[hydroxy(dimethyl)silyl]-5-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-methyloxolan-2-yl]ethyl]phenyl]benzamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CC(=O)N2Cc3ccccc3C[C@H]2CO)O[C@@H]1CCc1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C34H43N3O5Si/c1-22-30(17-10-23-8-15-28(16-9-23)36-34(40)24-11-13-27(35)14-12-24)42-31(33(22)43(2,3)41)19-32(39)37-20-26-7-5-4-6-25(26)18-29(37)21-38/h4-9,11-16,22,29-31,33,38,41H,10,17-21,35H2,1-3H3,(H,36,40)/t22-,29-,30+,31-,33+/m0/s1 |
| InChIKey | LUIWHAXLOJIULM-DOQSLRSGSA-N |
| XLogP | 4.76 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|