C26H43NO4Si — CID 23957613
2-[(2S,3R,4S,5R)-5-heptyl-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-1-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 23957613) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R)-5-heptyl-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-1-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 2-[(2S,3R,4S,5R)-5-heptyl-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-1-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 23957613 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 2-[(2S,3R,4S,5R)-5-heptyl-3-[hydroxy(dimethyl)silyl]-4-methyloxolan-2-yl]-1-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | CCCCCCC[C@H]1O[C@@H](CC(=O)N2Cc3ccccc3C[C@H]2CO)[C@H]([Si](C)(C)O)[C@H]1C |
| InChI | InChI=1S/C26H43NO4Si/c1-5-6-7-8-9-14-23-19(2)26(32(3,4)30)24(31-23)16-25(29)27-17-21-13-11-10-12-20(21)15-22(27)18-28/h10-13,19,22-24,26,28,30H,5-9,14-18H2,1-4H3/t19-,22-,23+,24-,26+/m0/s1 |
| InChIKey | NHMJHMDFSCZLKH-DIPFOELRSA-N |
| XLogP | 4.65 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|