C25H29N3O5Si — CID 23956034
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23956034) has the molecular formula C25H29N3O5Si and a molecular weight of 479.61 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23956034 |
| Molecular Formula | C25H29N3O5Si |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(1-oxophthalazin-2-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCO)O[C@]12C(=O)N(C)c1ccc(-n3ncc4ccccc4c3=O)cc12 |
| InChI | InChI=1S/C25H29N3O5Si/c1-15-22(34(3,4)32)21(11-12-29)33-25(15)19-13-17(9-10-20(19)27(2)24(25)31)28-23(30)18-8-6-5-7-16(18)14-26-28/h5-10,13-15,21-22,29,32H,11-12H2,1-4H3/t15-,21+,22-,25+/m0/s1 |
| InChIKey | BERWTPNRLWOKCY-MHOYTSCBSA-N |
| XLogP | 2.54 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|