C30H40N4O5Si — CID 23984135
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23984135) has the molecular formula C30H40N4O5Si and a molecular weight of 564.76 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23984135 |
| Molecular Formula | C30H40N4O5Si |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCO)O[C@@]12C(=O)N(C)c1ccc(N3CN(c4ccccc4)C4(CCNCC4)C3=O)cc12 |
| InChI | InChI=1S/C30H40N4O5Si/c1-20-26(40(3,4)38)25(12-17-35)39-30(20)23-18-22(10-11-24(23)32(2)28(30)37)33-19-34(21-8-6-5-7-9-21)29(27(33)36)13-15-31-16-14-29/h5-11,18,20,25-26,31,35,38H,12-17,19H2,1-4H3/t20-,25+,26-,30+/m1/s1 |
| InChIKey | RJMPPSQGGHUYSG-HWSYBFSRSA-N |
| XLogP | 2.78 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|