C30H39FN4O4Si — CID 23786606
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23786606) has the molecular formula C30H39FN4O4Si and a molecular weight of 566.75 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23786606 |
| Molecular Formula | C30H39FN4O4Si |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@]12C(=O)N(C)c1ccc(N3CN(c4ccccc4)C4(CCNCC4)C3=O)cc12 |
| InChI | InChI=1S/C30H39FN4O4Si/c1-20-26(40(3,4)31)25(12-17-36)39-30(20)23-18-22(10-11-24(23)33(2)28(30)38)34-19-35(21-8-6-5-7-9-21)29(27(34)37)13-15-32-16-14-29/h5-11,18,20,25-26,32,36H,12-17,19H2,1-4H3/t20-,25+,26-,30+/m0/s1 |
| InChIKey | FJQPPJPGUTXENG-ZLEDHLGDSA-N |
| XLogP | 3.75 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|