C30H42FN3O3Si — CID 23817375
3-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 23817375) has the molecular formula C30H42FN3O3Si and a molecular weight of 539.77 g/mol. Its IUPAC name is 3-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 23817375 |
| Molecular Formula | C30H42FN3O3Si |
| Molecular Weight | 539.77 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 3-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@H]1CCc1ccc(N2CN(c3ccccc3)C3(CCNCC3)C2=O)cc1 |
| InChI | InChI=1S/C30H42FN3O3Si/c1-22-26(37-27(15-20-35)28(22)38(2,3)31)14-11-23-9-12-24(13-10-23)33-21-34(25-7-5-4-6-8-25)30(29(33)36)16-18-32-19-17-30/h4-10,12-13,22,26-28,32,35H,11,14-21H2,1-3H3/t22-,26+,27-,28+/m1/s1 |
| InChIKey | ZVMAPWAXBYQDBM-NKKHJSFDSA-N |
| XLogP | 4.88 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|