C20H32FNO4Si — CID 23815727
(2S)-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-2-hydroxypropanamide (PubChem CID 23815727) has the molecular formula C20H32FNO4Si and a molecular weight of 397.56 g/mol. Its IUPAC name is (2S)-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 23815727 |
| Molecular Formula | C20H32FNO4Si |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2S)-N-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-2-hydroxypropanamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@H]1CCc1ccc(NC(=O)[C@H](C)O)cc1 |
| InChI | InChI=1S/C20H32FNO4Si/c1-13-17(26-18(11-12-23)19(13)27(3,4)21)10-7-15-5-8-16(9-6-15)22-20(25)14(2)24/h5-6,8-9,13-14,17-19,23-24H,7,10-12H2,1-4H3,(H,22,25)/t13-,14+,17+,18-,19+/m1/s1 |
| InChIKey | RZDODYJUXUOXIP-CZAUZLFCSA-N |
| XLogP | 3.27 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|