C29H32BrFN2O5Si — CID 23957243
(3S,3'S,4'R,5'S)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23957243) has the molecular formula C29H32BrFN2O5Si and a molecular weight of 615.57 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23957243 |
| Molecular Formula | C29H32BrFN2O5Si |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1cccn(-c2ccc(CN3C(=O)[C@@]4(O[C@@H](CCO)[C@H]([Si](C)(C)F)[C@H]4C)c4cc(Br)ccc43)cc2)c1=O |
| InChI | InChI=1S/C29H32BrFN2O5Si/c1-18-26(39(3,4)31)24(13-15-34)38-29(18)22-16-20(30)9-12-23(22)33(28(29)36)17-19-7-10-21(11-8-19)32-14-5-6-25(37-2)27(32)35/h5-12,14,16,18,24,26,34H,13,15,17H2,1-4H3/t18-,24+,26-,29+/m1/s1 |
| InChIKey | KWBGEPKLONBLDT-JVWPNUBJSA-N |
| XLogP | 5.31 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|