C30H34ClN3O5Si — CID 23845278
4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide (PubChem CID 23845278) has the molecular formula C30H34ClN3O5Si and a molecular weight of 580.16 g/mol. Its IUPAC name is 4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23845278 |
| Molecular Formula | C30H34ClN3O5Si |
| Molecular Weight | 580.16 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 4-amino-N-[3-[[(3R,3'R,4'S,5'R)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCO)O[C@]12C(=O)N(Cc1cccc(NC(=O)c3ccc(N)cc3)c1)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C30H34ClN3O5Si/c1-18-27(40(2,3)38)26(13-14-35)39-30(18)24-16-21(31)9-12-25(24)34(29(30)37)17-19-5-4-6-23(15-19)33-28(36)20-7-10-22(32)11-8-20/h4-12,15-16,18,26-27,35,38H,13-14,17,32H2,1-3H3,(H,33,36)/t18-,26+,27-,30+/m0/s1 |
| InChIKey | PIUOAPXHMHQWAQ-GCBBNJKYSA-N |
| XLogP | 4.90 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.16 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|