C39H49N3O6Si — CID 23815638
N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-3'-[(4-methoxyphenyl)-dimethylsilyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]acetamide (PubChem CID 23815638) has the molecular formula C39H49N3O6Si and a molecular weight of 683.92 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-3'-[(4-methoxyphenyl)-dimethylsilyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]acetamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-3'-[(4-methoxyphenyl)-dimethylsilyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]acetamide |
|---|---|
| PubChem CID | 23815638 |
| Molecular Formula | C39H49N3O6Si |
| Molecular Weight | 683.92 g/mol |
| Exact Mass | 683.34 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-2-[(2'R,3R,3'S,4'R)-3'-[(4-methoxyphenyl)-dimethylsilyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]acetamide |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CC(=O)N(CCO)Cc3ccccc3)O[C@]3(C(=O)Nc4ccc(N5CCCCCCC5=O)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C39H49N3O6Si/c1-27-37(49(3,4)31-18-16-30(47-2)17-19-31)34(25-36(45)41(22-23-43)26-28-12-8-7-9-13-28)48-39(27)32-24-29(15-20-33(32)40-38(39)46)42-21-11-6-5-10-14-35(42)44/h7-9,12-13,15-20,24,27,34,37,43H,5-6,10-11,14,21-23,25-26H2,1-4H3,(H,40,46)/t27-,34+,37-,39+/m0/s1 |
| InChIKey | HMJGJBTVJLKRKA-DKAOMURWSA-N |
| XLogP | 5.57 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|