C32H42FN3O5Si — CID 23816067
N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23816067) has the molecular formula C32H42FN3O5Si and a molecular weight of 595.79 g/mol. Its IUPAC name is N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23816067 |
| Molecular Formula | C32H42FN3O5Si |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[fluoro(dimethyl)silyl]-4'-methyl-2-oxo-5-(2-oxoazocan-1-yl)spiro[1H-indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@]12C(=O)Nc1ccc(N3CCCCCCC3=O)cc12 |
| InChI | InChI=1S/C32H42FN3O5Si/c1-22-30(42(2,3)33)27(20-29(39)35(17-18-37)21-23-11-7-6-8-12-23)41-32(22)25-19-24(14-15-26(25)34-31(32)40)36-16-10-5-4-9-13-28(36)38/h6-8,11-12,14-15,19,22,27,30,37H,4-5,9-10,13,16-18,20-21H2,1-3H3,(H,34,40)/t22-,27+,30-,32+/m1/s1 |
| InChIKey | BDVYBBSZXAVZHS-ACDLKQDXSA-N |
| XLogP | 5.12 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|