C32H34FN3O4Si — CID 23815549
N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-(1H-indol-3-yl)acetamide (PubChem CID 23815549) has the molecular formula C32H34FN3O4Si and a molecular weight of 571.73 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 23815549 |
| Molecular Formula | C32H34FN3O4Si |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-(1H-indol-3-yl)acetamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@]12C(=O)N(c1ccccc1)c1ccc(NC(=O)Cc3c[nH]c4ccccc34)cc12 |
| InChI | InChI=1S/C32H34FN3O4Si/c1-20-30(41(2,3)33)28(15-16-37)40-32(20)25-18-22(13-14-27(25)36(31(32)39)23-9-5-4-6-10-23)35-29(38)17-21-19-34-26-12-8-7-11-24(21)26/h4-14,18-20,28,30,34,37H,15-17H2,1-3H3,(H,35,38)/t20-,28+,30-,32+/m0/s1 |
| InChIKey | JYYDGTQPSOLNQZ-FQRCDWCCSA-N |
| XLogP | 6.18 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|