C27H40N8O3 — CID 23758078
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[[4-(2-bicyclo[2.2.1]heptanylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide (PubChem CID 23758078) has the molecular formula C27H40N8O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[[4-(2-bicyclo[2.2.1]heptanylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[[4-(2-bicyclo[2.2.1]heptanylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 23758078 |
| Molecular Formula | C27H40N8O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[[4-(2-bicyclo[2.2.1]heptanylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide |
| SMILES | C=CCNc1nc(NCc2ccc(C(=O)NCCOCCOCCN)cc2)nc(NC2CC3CCC2C3)n1 |
| InChI | InChI=1S/C27H40N8O3/c1-2-10-30-25-33-26(35-27(34-25)32-23-17-20-5-8-22(23)16-20)31-18-19-3-6-21(7-4-19)24(36)29-11-13-38-15-14-37-12-9-28/h2-4,6-7,20,22-23H,1,5,8-18,28H2,(H,29,36)(H3,30,31,32,33,34,35) |
| InChIKey | URUHZNGCVRPEKD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|