C9H15N3S2 — CID 2375960
5-[[(1R,2S)-2-methylcyclohexyl]amino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 2375960) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-methylcyclohexyl]amino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[[(1R,2S)-2-methylcyclohexyl]amino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 2375960 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 5-[[(1R,2S)-2-methylcyclohexyl]amino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | C[C@H]1CCCC[C@H]1Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C9H15N3S2/c1-6-4-2-3-5-7(6)10-8-11-12-9(13)14-8/h6-7H,2-5H2,1H3,(H,10,11)(H,12,13)/t6-,7+/m0/s1 |
| InChIKey | VPEXGPZGXPUORY-NKWVEPMBSA-N |
| XLogP | 3.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|