C13H12N2O5S — CID 23762747
2-[5-(2-anilino-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 23762747) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-[5-(2-anilino-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-(2-anilino-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 23762747 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[5-(2-anilino-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)SC(CC(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C13H12N2O5S/c16-10(14-8-4-2-1-3-5-8)6-9-12(19)15(7-11(17)18)13(20)21-9/h1-5,9H,6-7H2,(H,14,16)(H,17,18) |
| InChIKey | VYQKADVGKSGLFQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|