C19H15N3O6S — CID 7358041
2-[(5R)-2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 7358041) has the molecular formula C19H15N3O6S and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-[(5R)-2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(5R)-2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7358041 |
| Molecular Formula | C19H15N3O6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-[(5R)-2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(C[C@H]1SC(=O)N(CC(=O)c2ccccc2)C1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N3O6S/c23-15(12-4-2-1-3-5-12)11-21-18(25)16(29-19(21)26)10-17(24)20-13-6-8-14(9-7-13)22(27)28/h1-9,16H,10-11H2,(H,20,24)/t16-/m1/s1 |
| InChIKey | IQFMOTUOULVWGL-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|