C21H14ClN3O2S — CID 23764726
5-chloro-13-(4-methoxyphenyl)-6-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one (PubChem CID 23764726) has the molecular formula C21H14ClN3O2S and a molecular weight of 407.88 g/mol. Its IUPAC name is 5-chloro-13-(4-methoxyphenyl)-6-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one.
| Compound Name | 5-chloro-13-(4-methoxyphenyl)-6-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one |
|---|---|
| PubChem CID | 23764726 |
| Molecular Formula | C21H14ClN3O2S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 5-chloro-13-(4-methoxyphenyl)-6-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one |
| SMILES | COc1ccc(-c2csc3nc4c(cnc5c(C)c(Cl)ccc54)c(=O)n23)cc1 |
| InChI | InChI=1S/C21H14ClN3O2S/c1-11-16(22)8-7-14-18(11)23-9-15-19(14)24-21-25(20(15)26)17(10-28-21)12-3-5-13(27-2)6-4-12/h3-10H,1-2H3 |
| InChIKey | FUHXPDWPCDSTDF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|