C28H37N3O3 — CID 23768544
N-[2-[[(4-aminocyclohexyl)-(cyclohexanecarbonyl)amino]methyl]phenyl]-3-methoxybenzamide (PubChem CID 23768544) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-[[(4-aminocyclohexyl)-(cyclohexanecarbonyl)amino]methyl]phenyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[(4-aminocyclohexyl)-(cyclohexanecarbonyl)amino]methyl]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23768544 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[2-[[(4-aminocyclohexyl)-(cyclohexanecarbonyl)amino]methyl]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccccc2CN(C(=O)C2CCCCC2)C2CCC(N)CC2)c1 |
| InChI | InChI=1S/C28H37N3O3/c1-34-25-12-7-11-21(18-25)27(32)30-26-13-6-5-10-22(26)19-31(24-16-14-23(29)15-17-24)28(33)20-8-3-2-4-9-20/h5-7,10-13,18,20,23-24H,2-4,8-9,14-17,19,29H2,1H3,(H,30,32) |
| InChIKey | RLOOJCKHCBCVLD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |