About 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide
2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide (PubChem CID 23770459) has the molecular formula C13H20N4O2S
and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide |
| PubChem CID | 23770459 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide |
| SMILES | Cc1noc(C)c1C(=O)N1CCCN1C(=S)NC(C)C |
| InChI | InChI=1S/C13H20N4O2S/c1-8(2)14-13(20)17-7-5-6-16(17)12(18)11-9(3)15-19-10(11)4/h8H,5-7H2,1-4H3,(H,14,20) |
| InChIKey | REKPPRTVJAYZHL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide?
The IUPAC name of 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide (CID 23770459) is 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide.
What is the SMILES notation for 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide?
The canonical SMILES for 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide is Cc1noc(C)c1C(=O)N1CCCN1C(=S)NC(C)C.
What is the InChIKey of 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide?
The InChIKey is REKPPRTVJAYZHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2S/c1-8(2)14-13(20)17-7-5-6-16(17)12(18)11-9(3)15-19-10(11)4/h8H,5-7H2,1-4H3,(H,14,20).
What are the key properties of 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide?
2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide has a molecular weight of 296.40 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-propan-2-ylpyrazolidine-1-carbothioamide is sourced from PubChem (CID 23770459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).