C23H23NO3S — CID 23773662
[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 23773662) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 23773662 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(OCC(=O)n1c2c(c3ccccc31)CCCC2)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C23H23NO3S/c25-22(14-27-23(26)21-13-15-7-1-6-12-20(15)28-21)24-18-10-4-2-8-16(18)17-9-3-5-11-19(17)24/h2,4,8,10,13H,1,3,5-7,9,11-12,14H2 |
| InChIKey | CKRFSHGDVIDDLM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |