C27H27N3O3 — CID 23774111
[1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl] 2-phenyl-3H-benzimidazole-5-carboxylate (PubChem CID 23774111) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is [1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl] 2-phenyl-3H-benzimidazole-5-carboxylate.
| Compound Name | [1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl] 2-phenyl-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23774111 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [1-(2-ethyl-6-methylanilino)-1-oxobutan-2-yl] 2-phenyl-3H-benzimidazole-5-carboxylate |
| SMILES | CCc1cccc(C)c1NC(=O)C(CC)OC(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C27H27N3O3/c1-4-18-13-9-10-17(3)24(18)30-26(31)23(5-2)33-27(32)20-14-15-21-22(16-20)29-25(28-21)19-11-7-6-8-12-19/h6-16,23H,4-5H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | QRTRJFNWYJAKTE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |