C31H25N3O3S — CID 23744910
(1-oxo-1-phenothiazin-10-ylbutan-2-yl) 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 23744910) has the molecular formula C31H25N3O3S and a molecular weight of 519.63 g/mol. Its IUPAC name is (1-oxo-1-phenothiazin-10-ylbutan-2-yl) 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | (1-oxo-1-phenothiazin-10-ylbutan-2-yl) 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23744910 |
| Molecular Formula | C31H25N3O3S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (1-oxo-1-phenothiazin-10-ylbutan-2-yl) 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | CCC(OC(=O)c1ccc2nc(-c3ccc(C)cc3)[nH]c2c1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C31H25N3O3S/c1-3-26(30(35)34-24-8-4-6-10-27(24)38-28-11-7-5-9-25(28)34)37-31(36)21-16-17-22-23(18-21)33-29(32-22)20-14-12-19(2)13-15-20/h4-18,26H,3H2,1-2H3,(H,32,33) |
| InChIKey | OQBNBAUKDUHTAQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |