C36H53N3O5S — CID 23781978
hex-5-enyl (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23781978) has the molecular formula C36H53N3O5S and a molecular weight of 639.90 g/mol. Its IUPAC name is hex-5-enyl (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23781978 |
| Molecular Formula | C36H53N3O5S |
| Molecular Weight | 639.90 g/mol |
| Exact Mass | 639.37 |
| IUPAC Name | hex-5-enyl (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)c3ccc(N(CC)CC)cc3)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C36H53N3O5S/c1-8-13-14-15-21-44-35(43)30-29-22-25(7)36(45-29)31(30)33(41)39(28(23-40)24(6)10-3)32(36)34(42)38(20-9-2)27-18-16-26(17-19-27)37(11-4)12-5/h8-9,16-19,24-25,28-32,40H,1-2,10-15,20-23H2,3-7H3/t24-,25?,28-,29+,30-,31-,32?,36?/m0/s1 |
| InChIKey | OWMULMMZMNMIKH-VYJYHKISSA-N |
| XLogP | 5.70 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|