C28H37ClN2O5S — CID 23838727
ethyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23838727) has the molecular formula C28H37ClN2O5S and a molecular weight of 549.13 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23838727 |
| Molecular Formula | C28H37ClN2O5S |
| Molecular Weight | 549.13 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | ethyl (5S,6R,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)[C@@H](C)CC)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@@H]3CC(C)C12S3)c1ccccc1Cl |
| InChI | InChI=1S/C28H37ClN2O5S/c1-6-13-30(19-12-10-9-11-18(19)29)26(34)24-28-17(5)14-21(37-28)22(27(35)36-8-3)23(28)25(33)31(24)20(15-32)16(4)7-2/h6,9-12,16-17,20-24,32H,1,7-8,13-15H2,2-5H3/t16-,17?,20-,21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | WZRGYEUHHSWYTF-ZMIQIZGSSA-N |
| XLogP | 4.17 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|