C32H33N3O5 — CID 23782686
(5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782686) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782686 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C1N([C@H](CO)c2ccccc2)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@@H]3CCC12O3 |
| InChI | InChI=1S/C32H33N3O5/c1-19-10-9-11-20(2)27(19)34-30(38)28-32-17-16-24(40-32)25(29(37)33-22-14-7-4-8-15-22)26(32)31(39)35(28)23(18-36)21-12-5-3-6-13-21/h3-15,23-26,28,36H,16-18H2,1-2H3,(H,33,37)(H,34,38)/t23-,24+,25-,26+,28?,32?/m1/s1 |
| InChIKey | OVMLGVIGZJBDHF-GRBKHFDHSA-N |
| XLogP | 3.99 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |