C29H39N3O4S — CID 23783431
(5S,6S,7R)-2-N-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783431) has the molecular formula C29H39N3O4S and a molecular weight of 525.72 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783431 |
| Molecular Formula | C29H39N3O4S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | (5S,6S,7R)-2-N-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCC)C(=O)C1N([C@H](C)CO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@H]3CCC12S3 |
| InChI | InChI=1S/C29H39N3O4S/c1-5-8-18-30(16-6-2)28(36)25-29-15-14-22(37-29)23(24(29)27(35)32(25)20(4)19-33)26(34)31(17-7-3)21-12-10-9-11-13-21/h6-7,9-13,20,22-25,33H,2-3,5,8,14-19H2,1,4H3/t20-,22-,23+,24+,25?,29?/m1/s1 |
| InChIKey | INQCFQYVMFTLIC-QQNLCZSUSA-N |
| XLogP | 3.49 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|