C24H32N2O6 — CID 23785459
ethyl (1R,2R,5S,6S,7S)-2-(benzylcarbamoyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23785459) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-2-(benzylcarbamoyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-2-(benzylcarbamoyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23785459 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-2-(benzylcarbamoyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)NCc2ccccc2)N([C@@H](CO)C(C)C)C(=O)[C@@H]13 |
| InChI | InChI=1S/C24H32N2O6/c1-4-31-23(30)18-17-10-11-24(32-17)19(18)22(29)26(16(13-27)14(2)3)20(24)21(28)25-12-15-8-6-5-7-9-15/h5-9,14,16-20,27H,4,10-13H2,1-3H3,(H,25,28)/t16-,17-,18+,19+,20-,24+/m0/s1 |
| InChIKey | SOVSDSXACCZHEL-GSBGJRDASA-N |
| XLogP | 1.26 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |