C37H45N3O7 — CID 23785581
[(1R,2R)-2-[methyl(pent-4-enoyl)amino]-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23785581) has the molecular formula C37H45N3O7 and a molecular weight of 643.78 g/mol. Its IUPAC name is [(1R,2R)-2-[methyl(pent-4-enoyl)amino]-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(1R,2R)-2-[methyl(pent-4-enoyl)amino]-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23785581 |
| Molecular Formula | C37H45N3O7 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | [(1R,2R)-2-[methyl(pent-4-enoyl)amino]-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)N(C)[C@H](C)[C@H](OC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)N(CC=C)Cc2ccccc2)N(CCO)C(=O)[C@@H]13)c1ccccc1 |
| InChI | InChI=1S/C37H45N3O7/c1-5-7-18-29(42)38(4)25(3)32(27-16-12-9-13-17-27)46-36(45)30-28-19-20-37(47-28)31(30)34(43)40(22-23-41)33(37)35(44)39(21-6-2)24-26-14-10-8-11-15-26/h5-6,8-17,25,28,30-33,41H,1-2,7,18-24H2,3-4H3/t25-,28+,30-,31-,32+,33+,37-/m1/s1 |
| InChIKey | CTOSZLYHCKLTOA-LOPSOJSNSA-N |
| XLogP | 3.67 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|