C40H51N3O7 — CID 23756581
[(1R,2S)-2-(pent-4-enoylamino)-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23756581) has the molecular formula C40H51N3O7 and a molecular weight of 685.86 g/mol. Its IUPAC name is [(1R,2S)-2-(pent-4-enoylamino)-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(1R,2S)-2-(pent-4-enoylamino)-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23756581 |
| Molecular Formula | C40H51N3O7 |
| Molecular Weight | 685.86 g/mol |
| Exact Mass | 685.37 |
| IUPAC Name | [(1R,2S)-2-(pent-4-enoylamino)-1-phenylpropyl] (1R,2R,5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)N[C@@H](C)[C@H](OC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)N(CC=C)Cc2ccccc2)N(CCCCCCO)C(=O)[C@@H]13)c1ccccc1 |
| InChI | InChI=1S/C40H51N3O7/c1-4-6-21-32(45)41-28(3)35(30-19-13-10-14-20-30)49-39(48)33-31-22-23-40(50-31)34(33)37(46)43(25-15-7-8-16-26-44)36(40)38(47)42(24-5-2)27-29-17-11-9-12-18-29/h4-5,9-14,17-20,28,31,33-36,44H,1-2,6-8,15-16,21-27H2,3H3,(H,41,45)/t28-,31-,33+,34+,35-,36-,40+/m0/s1 |
| InChIKey | RNXUSBJFPCUSSD-SYLGGRMVSA-N |
| XLogP | 4.88 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|