C36H51N3O7 — CID 23899857
[(1S,2R)-2-(pent-4-enoylamino)-1-phenylpropyl] (1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23899857) has the molecular formula C36H51N3O7 and a molecular weight of 637.82 g/mol. Its IUPAC name is [(1S,2R)-2-(pent-4-enoylamino)-1-phenylpropyl] (1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(1S,2R)-2-(pent-4-enoylamino)-1-phenylpropyl] (1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23899857 |
| Molecular Formula | C36H51N3O7 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | [(1S,2R)-2-(pent-4-enoylamino)-1-phenylpropyl] (1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)N[C@H](C)[C@@H](OC(=O)[C@@H]1[C@H]2C(=O)N(CCCCO)[C@H](C(=O)N(CC=C)CCCCC)[C@]23CC[C@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C36H51N3O7/c1-5-8-13-22-38(21-7-3)34(43)32-36-20-19-27(46-36)29(30(36)33(42)39(32)23-14-15-24-40)35(44)45-31(26-16-11-10-12-17-26)25(4)37-28(41)18-9-6-2/h6-7,10-12,16-17,25,27,29-32,40H,2-3,5,8-9,13-15,18-24H2,1,4H3,(H,37,41)/t25-,27-,29+,30+,31-,32-,36+/m1/s1 |
| InChIKey | OESQNZOSVLSESP-YVZAZAMVSA-N |
| XLogP | 4.09 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|