C37H53N3O7 — CID 23756916
[(2S)-2-[[(1S,2S,5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate (PubChem CID 23756916) has the molecular formula C37H53N3O7 and a molecular weight of 651.85 g/mol. Its IUPAC name is [(2S)-2-[[(1S,2S,5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate.
| Compound Name | [(2S)-2-[[(1S,2S,5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 23756916 |
| Molecular Formula | C37H53N3O7 |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | [(2S)-2-[[(1S,2S,5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@@H](NC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)[C@H](C(=O)N(CC=C)CCCCC)[C@]23CC[C@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C37H53N3O7/c1-4-7-14-23-39(22-6-3)36(45)33-37-21-20-29(47-37)31(32(37)35(44)40(33)24-15-9-10-16-25-41)34(43)38-28(27-17-12-11-13-18-27)26-46-30(42)19-8-5-2/h5-6,11-13,17-18,28-29,31-33,41H,2-4,7-10,14-16,19-26H2,1H3,(H,38,43)/t28-,29-,31+,32+,33-,37+/m1/s1 |
| InChIKey | PQRQGURBNVOJAB-UTWWUWBZSA-N |
| XLogP | 4.49 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|