C38H47N3O7 — CID 23983485
[(2R)-2-[[(1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate (PubChem CID 23983485) has the molecular formula C38H47N3O7 and a molecular weight of 657.81 g/mol. Its IUPAC name is [(2R)-2-[[(1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate.
| Compound Name | [(2R)-2-[[(1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 23983485 |
| Molecular Formula | C38H47N3O7 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.34 |
| IUPAC Name | [(2R)-2-[[(1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H](NC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCO)[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@]23CC[C@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C38H47N3O7/c1-3-5-19-31(43)47-26-29(28-17-11-7-12-18-28)39-35(44)32-30-20-21-38(48-30)33(32)36(45)41(23-13-8-14-24-42)34(38)37(46)40(22-4-2)25-27-15-9-6-10-16-27/h3-4,6-7,9-12,15-18,29-30,32-34,42H,1-2,5,8,13-14,19-26H2,(H,39,44)/t29-,30+,32-,33-,34+,38-/m0/s1 |
| InChIKey | KKRDOGFVQJVSIM-RSNNGULASA-N |
| XLogP | 4.11 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|